Ciproheptadina

De Wikipedia, la enciclopedia libre
Saltar a: navegación, búsqueda
Cyproheptadine.svg

| Imagen= | Nombre_IUPAC = | width=180 | Número_CAS = | Prefijo_ATC= | Sufijo_ATC= | PubChem= | DrugBank= | C=16 | H=25 | N=1 | O=2 | Peos_molecular = 263.4 g/mol | smiles = CN(C)C[C@@H]2CCCC[C@@]2(O)c1cccc(OC)c1 | Biodisponibilidad = 68–72% Incrementa con dosis repetidas. | Unión_proteica = 20% | Metabolismo = Hepático | Vida_media_eliminación = 5–7 horas | Excreción = Renal | pregnancy_AU = C | pregnancy_US = C | pregnancy_category = C | legal_AU = S4 | legal_CA = | legal_UK = POM | legal_US = | legal_status = | Vías_administración= oral, IV, IM }}--> Ciproheptadina (Periactin®) al estado de clorhidrato es un agente antihistamínico/anticolinérgico y antiserotonérgico. También actúa como un antagonista HT-5 y bloqueador del canal de calcio.[1] piridoxal fosfato de ciproheptadina es la dihexazina.

Referencias[editar]

  1. Lowe DA, Matthews EK, Richardson BP (noviembre de 1981). «The calcium antagonistic effects of cyproheptadine on contraction, membrane electrical events and calcium influx in the guinea-pig taenia coli». British Journal of Pharmacology 74 (3): 651-63. PMC 2071752. PMID 6271323.